About [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate
[4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174848374) has the molecular formula C17H21F4NO2
and a molecular weight of 347.35 g/mol. Its IUPAC name is [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate |
| PubChem CID | 174848374 |
| Molecular Formula | C17H21F4NO2 |
| Molecular Weight | 347.35 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(c2ccc(F)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C17H21F4NO2/c1-16(2,3)15(23)24-22-8-6-11(7-9-22)13-5-4-12(18)10-14(13)17(19,20)21/h4-5,10-11H,6-9H2,1-3H3 |
| InChIKey | ZPALMFROFKVHNF-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.35 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate?
The IUPAC name of [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate (CID 174848374) is [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate.
What is the SMILES notation for [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate?
The canonical SMILES for [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate is CC(C)(C)C(=O)ON1CCC(c2ccc(F)cc2C(F)(F)F)CC1.
What is the InChIKey of [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate?
The InChIKey is ZPALMFROFKVHNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21F4NO2/c1-16(2,3)15(23)24-22-8-6-11(7-9-22)13-5-4-12(18)10-14(13)17(19,20)21/h4-5,10-11H,6-9H2,1-3H3.
What are the key properties of [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate?
[4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate has a molecular weight of 347.35 g/mol, XLogP of 4.53, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[4-fluoro-2-(trifluoromethyl)phenyl]piperidin-1-yl] 2,2-dimethylpropanoate is sourced from PubChem (CID 174848374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).