C15H21ClN2O2 — CID 174622965
[4-(4-chloro-2-pyridinyl)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174622965) has the molecular formula C15H21ClN2O2 and a molecular weight of 296.80 g/mol. Its IUPAC name is [4-(4-chloro-2-pyridinyl)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(4-chloro-2-pyridinyl)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174622965 |
| Molecular Formula | C15H21ClN2O2 |
| Molecular Weight | 296.80 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | [4-(4-chloro-2-pyridinyl)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(c2cc(Cl)ccn2)CC1 |
| InChI | InChI=1S/C15H21ClN2O2/c1-15(2,3)14(19)20-18-8-5-11(6-9-18)13-10-12(16)4-7-17-13/h4,7,10-11H,5-6,8-9H2,1-3H3 |
| InChIKey | OIOPPGVYQHQGPJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.80 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |