C16H21Cl2NO3 — CID 174800010
[4-(2,4-dichlorophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174800010) has the molecular formula C16H21Cl2NO3 and a molecular weight of 346.25 g/mol. Its IUPAC name is [4-(2,4-dichlorophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [4-(2,4-dichlorophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174800010 |
| Molecular Formula | C16H21Cl2NO3 |
| Molecular Weight | 346.25 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | [4-(2,4-dichlorophenoxy)piperidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)ON1CCC(Oc2ccc(Cl)cc2Cl)CC1 |
| InChI | InChI=1S/C16H21Cl2NO3/c1-16(2,3)15(20)22-19-8-6-12(7-9-19)21-14-5-4-11(17)10-13(14)18/h4-5,10,12H,6-9H2,1-3H3 |
| InChIKey | HEPMTFVTUOSQND-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.25 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |