About 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane
4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane (PubChem CID 142482897) has the molecular formula C18H26Cl2N2O2
and a molecular weight of 373.32 g/mol. Its IUPAC name is 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane.
Molecular Properties
| Compound Name | 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane |
| PubChem CID | 142482897 |
| Molecular Formula | C18H26Cl2N2O2 |
| Molecular Weight | 373.32 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane |
| SMILES | CC.O=C(Cl)N1CCC(Oc2ccc(Cl)cc2N2CCCC2)CC1 |
| InChI | InChI=1S/C16H20Cl2N2O2.C2H6/c17-12-3-4-15(14(11-12)19-7-1-2-8-19)22-13-5-9-20(10-6-13)16(18)21;1-2/h3-4,11,13H,1-2,5-10H2;1-2H3 |
| InChIKey | MPBMWVUPYIAEQB-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.32 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane?
The IUPAC name of 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane (CID 142482897) is 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane.
What is the SMILES notation for 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane?
The canonical SMILES for 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane is CC.O=C(Cl)N1CCC(Oc2ccc(Cl)cc2N2CCCC2)CC1.
What is the InChIKey of 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane?
The InChIKey is MPBMWVUPYIAEQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Cl2N2O2.C2H6/c17-12-3-4-15(14(11-12)19-7-1-2-8-19)22-13-5-9-20(10-6-13)16(18)21;1-2/h3-4,11,13H,1-2,5-10H2;1-2H3.
What are the key properties of 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane?
4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane has a molecular weight of 373.32 g/mol, XLogP of 5.17, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-chloro-2-pyrrolidin-1-ylphenoxy)piperidine-1-carbonyl chloride;ethane is sourced from PubChem (CID 142482897), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).