C21H28ClNO4 — CID 78861590
(3-methylcyclohexyl) 1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxylate (PubChem CID 78861590) has the molecular formula C21H28ClNO4 and a molecular weight of 393.91 g/mol. Its IUPAC name is (3-methylcyclohexyl) 1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxylate.
| Compound Name | (3-methylcyclohexyl) 1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 78861590 |
| Molecular Formula | C21H28ClNO4 |
| Molecular Weight | 393.91 g/mol |
| Exact Mass | 393.17 |
| IUPAC Name | (3-methylcyclohexyl) 1-(5-chloro-2-methoxybenzoyl)piperidine-4-carboxylate |
| SMILES | COc1ccc(Cl)cc1C(=O)N1CCC(C(=O)OC2CCCC(C)C2)CC1 |
| InChI | InChI=1S/C21H28ClNO4/c1-14-4-3-5-17(12-14)27-21(25)15-8-10-23(11-9-15)20(24)18-13-16(22)6-7-19(18)26-2/h6-7,13-15,17H,3-5,8-12H2,1-2H3 |
| InChIKey | QKVGWLNENISULZ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.91 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |