C16H22N2O4 — CID 174722000
[3-(2,5-dimethyl-4-nitrophenyl)azetidin-1-yl] 2,2-dimethylpropanoate (PubChem CID 174722000) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is [3-(2,5-dimethyl-4-nitrophenyl)azetidin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [3-(2,5-dimethyl-4-nitrophenyl)azetidin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 174722000 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [3-(2,5-dimethyl-4-nitrophenyl)azetidin-1-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1cc([N+](=O)[O-])c(C)cc1C1CN(OC(=O)C(C)(C)C)C1 |
| InChI | InChI=1S/C16H22N2O4/c1-10-7-14(18(20)21)11(2)6-13(10)12-8-17(9-12)22-15(19)16(3,4)5/h6-7,12H,8-9H2,1-5H3 |
| InChIKey | IUBOJJBLEMVTAL-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|