C16H24N4O4 — CID 175265910
[(2S)-2-methyl-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-1-yl] 2,2-dimethylpropanoate (PubChem CID 175265910) has the molecular formula C16H24N4O4 and a molecular weight of 336.39 g/mol. Its IUPAC name is [(2S)-2-methyl-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-2-methyl-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 175265910 |
| Molecular Formula | C16H24N4O4 |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | [(2S)-2-methyl-4-(6-methyl-5-nitro-2-pyridinyl)piperazin-1-yl] 2,2-dimethylpropanoate |
| SMILES | Cc1nc(N2CCN(OC(=O)C(C)(C)C)[C@@H](C)C2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H24N4O4/c1-11-10-18(8-9-19(11)24-15(21)16(3,4)5)14-7-6-13(20(22)23)12(2)17-14/h6-7,11H,8-10H2,1-5H3/t11-/m0/s1 |
| InChIKey | VJBVTWRFTOSFDI-NSHDSACASA-N |
| XLogP | 2.31 |
| TPSA | 88.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|