3-fluoro-4-(methylamino)piperidine-1-carboxylic acid

C7H13FN2O2 — CID 91177014

IUPAC3-fluoro-4-(methylamino)piperidine-1-carboxylic acid
SMILESCNC1CCN(C(=O)O)CC1F
InChIInChI=1S/C7H13FN2O2/c1-9-6-2-3-10(7(11)12)4-5(6)8/h5-6,9H,2-4H2,1H3,(H,11,12)
InChIKeyBVCFQVZXMYXCGV-UHFFFAOYSA-N
MW176.19 g/mol
LogP0.30
Rot. Bonds1

About 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid

3-fluoro-4-(methylamino)piperidine-1-carboxylic acid (PubChem CID 91177014) has the molecular formula C7H13FN2O2 and a molecular weight of 176.19 g/mol. Its IUPAC name is 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid.

Molecular Properties

Compound Name3-fluoro-4-(methylamino)piperidine-1-carboxylic acid
PubChem CID91177014
Molecular FormulaC7H13FN2O2
Molecular Weight176.19 g/mol
Exact Mass176.10
IUPAC Name3-fluoro-4-(methylamino)piperidine-1-carboxylic acid
SMILESCNC1CCN(C(=O)O)CC1F
InChIInChI=1S/C7H13FN2O2/c1-9-6-2-3-10(7(11)12)4-5(6)8/h5-6,9H,2-4H2,1H3,(H,11,12)
InChIKeyBVCFQVZXMYXCGV-UHFFFAOYSA-N
XLogP0.30
TPSA52.57 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500176.19
LogP ≤ 50.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

4-Amino-1-piperidinecarboxylic acid
CID 445262
Methyl 4-aminopiperidine-1-carboxylate
CID 28377655
Piperidin-4-yl-carbamic acid
CID 19787930
2-Ethylpiperazine-1-carboxylic acid
CID 22220032
[1-(2,2,2-Trifluoroethyl)piperidin-4-yl]carbamic acid
CID 18425492
methyl N-piperidin-4-yl-N-(2,2,2-trifluoroethyl)carbamate
CID 43604140
N-piperidin-4-ylcarbamoyl fluoride
CID 60070763
N-(1-ethylpiperidin-4-yl)carbamoyl fluoride
CID 60070764
4-Amino-3-fluoropiperidine-1-carboxylic acid
CID 66782220
2-(1-Fluorobutyl)piperazine-1-carboxylic acid
CID 66820647
(3R,4S)-4-(tert-butylamino)-3-fluoropiperidine-1-carboxylic acid
CID 67003509
tert-butyl-[(3S,4S)-4-fluoropiperidin-3-yl]carbamic acid
CID 67045320

Frequently Asked Questions

What is the IUPAC name of 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid?
The IUPAC name of 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid (CID 91177014) is 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid.
What is the SMILES notation for 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid?
The canonical SMILES for 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid is CNC1CCN(C(=O)O)CC1F.
What is the InChIKey of 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid?
The InChIKey is BVCFQVZXMYXCGV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13FN2O2/c1-9-6-2-3-10(7(11)12)4-5(6)8/h5-6,9H,2-4H2,1H3,(H,11,12).
What are the key properties of 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid?
3-fluoro-4-(methylamino)piperidine-1-carboxylic acid has a molecular weight of 176.19 g/mol, XLogP of 0.30, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-4-(methylamino)piperidine-1-carboxylic acid is sourced from PubChem (CID 91177014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).