About butane;N-methylmorpholine-4-carboxamide;propane
butane;N-methylmorpholine-4-carboxamide;propane (PubChem CID 143336598) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is butane;N-methylmorpholine-4-carboxamide;propane.
Molecular Properties
| Compound Name | butane;N-methylmorpholine-4-carboxamide;propane |
| PubChem CID | 143336598 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | butane;N-methylmorpholine-4-carboxamide;propane |
| SMILES | CCC.CCCC.CNC(=O)N1CCOCC1 |
| InChI | InChI=1S/C6H12N2O2.C4H10.C3H8/c1-7-6(9)8-2-4-10-5-3-8;1-3-4-2;1-3-2/h2-5H2,1H3,(H,7,9);3-4H2,1-2H3;3H2,1-2H3 |
| InChIKey | JTSICDZHCYYXJG-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze butane;N-methylmorpholine-4-carboxamide;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butane;N-methylmorpholine-4-carboxamide;propane?
The IUPAC name of butane;N-methylmorpholine-4-carboxamide;propane (CID 143336598) is butane;N-methylmorpholine-4-carboxamide;propane.
What is the SMILES notation for butane;N-methylmorpholine-4-carboxamide;propane?
The canonical SMILES for butane;N-methylmorpholine-4-carboxamide;propane is CCC.CCCC.CNC(=O)N1CCOCC1.
What is the InChIKey of butane;N-methylmorpholine-4-carboxamide;propane?
The InChIKey is JTSICDZHCYYXJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O2.C4H10.C3H8/c1-7-6(9)8-2-4-10-5-3-8;1-3-4-2;1-3-2/h2-5H2,1H3,(H,7,9);3-4H2,1-2H3;3H2,1-2H3.
What are the key properties of butane;N-methylmorpholine-4-carboxamide;propane?
butane;N-methylmorpholine-4-carboxamide;propane has a molecular weight of 246.39 g/mol, XLogP of 2.88, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for butane;N-methylmorpholine-4-carboxamide;propane is sourced from PubChem (CID 143336598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).