C20H22N2O4 — CID 97285821
(6S)-N-[4-(3-acetylphenyl)phenyl]-6-hydroxy-1,4-oxazepane-4-carboxamide (PubChem CID 97285821) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is (6S)-N-[4-(3-acetylphenyl)phenyl]-6-hydroxy-1,4-oxazepane-4-carboxamide.
| Compound Name | (6S)-N-[4-(3-acetylphenyl)phenyl]-6-hydroxy-1,4-oxazepane-4-carboxamide |
|---|---|
| PubChem CID | 97285821 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | (6S)-N-[4-(3-acetylphenyl)phenyl]-6-hydroxy-1,4-oxazepane-4-carboxamide |
| SMILES | CC(=O)c1cccc(-c2ccc(NC(=O)N3CCOC[C@@H](O)C3)cc2)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-14(23)16-3-2-4-17(11-16)15-5-7-18(8-6-15)21-20(25)22-9-10-26-13-19(24)12-22/h2-8,11,19,24H,9-10,12-13H2,1H3,(H,21,25)/t19-/m0/s1 |
| InChIKey | MJBABIBMMCMRNO-IBGZPJMESA-N |
| XLogP | 2.78 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |