C21H23NO5 — CID 124974025
4-[[(6R)-4-phenylmethoxycarbonyl-1,4-oxazepan-6-yl]methyl]benzoic acid (PubChem CID 124974025) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is 4-[[(6R)-4-phenylmethoxycarbonyl-1,4-oxazepan-6-yl]methyl]benzoic acid.
| Compound Name | 4-[[(6R)-4-phenylmethoxycarbonyl-1,4-oxazepan-6-yl]methyl]benzoic acid |
|---|---|
| PubChem CID | 124974025 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | 4-[[(6R)-4-phenylmethoxycarbonyl-1,4-oxazepan-6-yl]methyl]benzoic acid |
| SMILES | O=C(O)c1ccc(C[C@H]2COCCN(C(=O)OCc3ccccc3)C2)cc1 |
| InChI | InChI=1S/C21H23NO5/c23-20(24)19-8-6-16(7-9-19)12-18-13-22(10-11-26-14-18)21(25)27-15-17-4-2-1-3-5-17/h1-9,18H,10-15H2,(H,23,24)/t18-/m1/s1 |
| InChIKey | KNWLJXIJIJIEIV-GOSISDBHSA-N |
| XLogP | 3.21 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |