C14H19NO5 — CID 122547436
benzyl (6R,7R)-6,7-dihydroxy-1,4-oxazocane-4-carboxylate (PubChem CID 122547436) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is benzyl (6R,7R)-6,7-dihydroxy-1,4-oxazocane-4-carboxylate.
| Compound Name | benzyl (6R,7R)-6,7-dihydroxy-1,4-oxazocane-4-carboxylate |
|---|---|
| PubChem CID | 122547436 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | benzyl (6R,7R)-6,7-dihydroxy-1,4-oxazocane-4-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCOC[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C14H19NO5/c16-12-8-15(6-7-19-10-13(12)17)14(18)20-9-11-4-2-1-3-5-11/h1-5,12-13,16-17H,6-10H2/t12-,13-/m1/s1 |
| InChIKey | OCLVNZWNKBMOCZ-CHWSQXEVSA-N |
| XLogP | 0.38 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |