C25H32BrNO4 — CID 67032537
tert-butyl 3-[2-[4-[(4-bromophenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate (PubChem CID 67032537) has the molecular formula C25H32BrNO4 and a molecular weight of 490.44 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-[(4-bromophenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate.
| Compound Name | tert-butyl 3-[2-[4-[(4-bromophenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 67032537 |
| Molecular Formula | C25H32BrNO4 |
| Molecular Weight | 490.44 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | tert-butyl 3-[2-[4-[(4-bromophenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate |
| SMILES | Cc1cc(OCc2ccc(Br)cc2)ccc1C1CN(CCC(=O)OC(C)(C)C)CCO1 |
| InChI | InChI=1S/C25H32BrNO4/c1-18-15-21(30-17-19-5-7-20(26)8-6-19)9-10-22(18)23-16-27(13-14-29-23)12-11-24(28)31-25(2,3)4/h5-10,15,23H,11-14,16-17H2,1-4H3 |
| InChIKey | WNCDSEBJZSNTJC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.44 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |