C22H24F3NO4 — CID 67032139
3-[2-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoic acid (PubChem CID 67032139) has the molecular formula C22H24F3NO4 and a molecular weight of 423.43 g/mol. Its IUPAC name is 3-[2-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 3-[2-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 67032139 |
| Molecular Formula | C22H24F3NO4 |
| Molecular Weight | 423.43 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 3-[2-[2-methyl-4-[[4-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoic acid |
| SMILES | Cc1cc(OCc2ccc(C(F)(F)F)cc2)ccc1C1CN(CCC(=O)O)CCO1 |
| InChI | InChI=1S/C22H24F3NO4/c1-15-12-18(30-14-16-2-4-17(5-3-16)22(23,24)25)6-7-19(15)20-13-26(10-11-29-20)9-8-21(27)28/h2-7,12,20H,8-11,13-14H2,1H3,(H,27,28) |
| InChIKey | GMDYGNQNHANWHA-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |