C20H29NO4 — CID 51002016
3-[2-[4-(cyclopentylmethoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid (PubChem CID 51002016) has the molecular formula C20H29NO4 and a molecular weight of 347.46 g/mol. Its IUPAC name is 3-[2-[4-(cyclopentylmethoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-(cyclopentylmethoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 51002016 |
| Molecular Formula | C20H29NO4 |
| Molecular Weight | 347.46 g/mol |
| Exact Mass | 347.21 |
| IUPAC Name | 3-[2-[4-(cyclopentylmethoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid |
| SMILES | Cc1cc(OCC2CCCC2)ccc1C1CN(CCC(=O)O)CCO1 |
| InChI | InChI=1S/C20H29NO4/c1-15-12-17(25-14-16-4-2-3-5-16)6-7-18(15)19-13-21(10-11-24-19)9-8-20(22)23/h6-7,12,16,19H,2-5,8-11,13-14H2,1H3,(H,22,23) |
| InChIKey | QNWNSCZZPSITDC-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.46 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |