C29H33NO4 — CID 152762805
3-[2-[4-(1,3-diphenylpropoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid (PubChem CID 152762805) has the molecular formula C29H33NO4 and a molecular weight of 459.59 g/mol. Its IUPAC name is 3-[2-[4-(1,3-diphenylpropoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-(1,3-diphenylpropoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 152762805 |
| Molecular Formula | C29H33NO4 |
| Molecular Weight | 459.59 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 3-[2-[4-(1,3-diphenylpropoxy)-2-methylphenyl]morpholin-4-yl]propanoic acid |
| SMILES | Cc1cc(OC(CCc2ccccc2)c2ccccc2)ccc1C1CN(CCC(=O)O)CCO1 |
| InChI | InChI=1S/C29H33NO4/c1-22-20-25(13-14-26(22)28-21-30(18-19-33-28)17-16-29(31)32)34-27(24-10-6-3-7-11-24)15-12-23-8-4-2-5-9-23/h2-11,13-14,20,27-28H,12,15-19,21H2,1H3,(H,31,32) |
| InChIKey | CRBLROGLBOFVAY-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.59 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |