C25H33NO4 — CID 51002165
3-[2-[4-[(4-butylphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoic acid (PubChem CID 51002165) has the molecular formula C25H33NO4 and a molecular weight of 411.54 g/mol. Its IUPAC name is 3-[2-[4-[(4-butylphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-[(4-butylphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 51002165 |
| Molecular Formula | C25H33NO4 |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 3-[2-[4-[(4-butylphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoic acid |
| SMILES | CCCCc1ccc(COc2ccc(C3CN(CCC(=O)O)CCO3)c(C)c2)cc1 |
| InChI | InChI=1S/C25H33NO4/c1-3-4-5-20-6-8-21(9-7-20)18-30-22-10-11-23(19(2)16-22)24-17-26(14-15-29-24)13-12-25(27)28/h6-11,16,24H,3-5,12-15,17-18H2,1-2H3,(H,27,28) |
| InChIKey | WKEOEDOOQSQNNO-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |