About tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate
tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate (PubChem CID 67032562) has the molecular formula C27H37NO6
and a molecular weight of 471.59 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate.
Molecular Properties
| Compound Name | tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate |
| PubChem CID | 67032562 |
| Molecular Formula | C27H37NO6 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.26 |
| IUPAC Name | tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate |
| SMILES | COc1cccc(COc2ccc(C3CN(CCC(=O)OC(C)(C)C)CCO3)c(C)c2)c1OC |
| InChI | InChI=1S/C27H37NO6/c1-19-16-21(33-18-20-8-7-9-23(30-5)26(20)31-6)10-11-22(19)24-17-28(14-15-32-24)13-12-25(29)34-27(2,3)4/h7-11,16,24H,12-15,17-18H2,1-6H3 |
| InChIKey | WWVJQIHHZDUJGW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 66.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate?
The IUPAC name of tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate (CID 67032562) is tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate.
What is the SMILES notation for tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate?
The canonical SMILES for tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate is COc1cccc(COc2ccc(C3CN(CCC(=O)OC(C)(C)C)CCO3)c(C)c2)c1OC.
What is the InChIKey of tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate?
The InChIKey is WWVJQIHHZDUJGW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H37NO6/c1-19-16-21(33-18-20-8-7-9-23(30-5)26(20)31-6)10-11-22(19)24-17-28(14-15-32-24)13-12-25(29)34-27(2,3)4/h7-11,16,24H,12-15,17-18H2,1-6H3.
What are the key properties of tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate?
tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate has a molecular weight of 471.59 g/mol, XLogP of 4.70, 9 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 3-[2-[4-[(2,3-dimethoxyphenyl)methoxy]-2-methylphenyl]morpholin-4-yl]propanoate is sourced from PubChem (CID 67032562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).