C14H19F2NO3 — CID 111432790
2-[2-[2-(3,4-difluorophenyl)morpholin-4-yl]ethoxy]ethanol (PubChem CID 111432790) has the molecular formula C14H19F2NO3 and a molecular weight of 287.31 g/mol. Its IUPAC name is 2-[2-[2-(3,4-difluorophenyl)morpholin-4-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[2-(3,4-difluorophenyl)morpholin-4-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 111432790 |
| Molecular Formula | C14H19F2NO3 |
| Molecular Weight | 287.31 g/mol |
| Exact Mass | 287.13 |
| IUPAC Name | 2-[2-[2-(3,4-difluorophenyl)morpholin-4-yl]ethoxy]ethanol |
| SMILES | OCCOCCN1CCOC(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H19F2NO3/c15-12-2-1-11(9-13(12)16)14-10-17(4-7-20-14)3-6-19-8-5-18/h1-2,9,14,18H,3-8,10H2 |
| InChIKey | ULMCHLWLQDLLEF-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.31 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|