C26H26F10N2O3 — CID 142767961
(2R)-2-(3,4-difluorophenyl)-4-[(2S)-2-[(2S)-3-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]morpholine (PubChem CID 142767961) has the molecular formula C26H26F10N2O3 and a molecular weight of 604.49 g/mol. Its IUPAC name is (2R)-2-(3,4-difluorophenyl)-4-[(2S)-2-[(2S)-3-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]morpholine.
| Compound Name | (2R)-2-(3,4-difluorophenyl)-4-[(2S)-2-[(2S)-3-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]morpholine |
|---|---|
| PubChem CID | 142767961 |
| Molecular Formula | C26H26F10N2O3 |
| Molecular Weight | 604.49 g/mol |
| Exact Mass | 604.18 |
| IUPAC Name | (2R)-2-(3,4-difluorophenyl)-4-[(2S)-2-[(2S)-3-[(2R)-2-(3,4-difluorophenyl)morpholin-4-yl]-1,1,1-trifluoropropan-2-yl]oxy-3,3,3-trifluoropropyl]morpholine |
| SMILES | Fc1ccc([C@@H]2CN(C[C@H](O[C@@H](CN3CCO[C@H](c4ccc(F)c(F)c4)C3)C(F)(F)F)C(F)(F)F)CCO2)cc1F |
| InChI | InChI=1S/C26H26F10N2O3/c27-17-3-1-15(9-19(17)29)21-11-37(5-7-39-21)13-23(25(31,32)33)41-24(26(34,35)36)14-38-6-8-40-22(12-38)16-2-4-18(28)20(30)10-16/h1-4,9-10,21-24H,5-8,11-14H2/t21-,22-,23-,24-/m0/s1 |
| InChIKey | NUWRAVORKJOXER-ZJZGAYNASA-N |
| XLogP | 5.57 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.49 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |