C20H23F2NO3 — CID 138959012
1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(4-methylphenoxy)propan-2-ol (PubChem CID 138959012) has the molecular formula C20H23F2NO3 and a molecular weight of 363.40 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(4-methylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(4-methylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 138959012 |
| Molecular Formula | C20H23F2NO3 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(4-methylphenoxy)propan-2-ol |
| SMILES | Cc1ccc(OCC(O)CN2CCOC(c3ccc(F)c(F)c3)C2)cc1 |
| InChI | InChI=1S/C20H23F2NO3/c1-14-2-5-17(6-3-14)26-13-16(24)11-23-8-9-25-20(12-23)15-4-7-18(21)19(22)10-15/h2-7,10,16,20,24H,8-9,11-13H2,1H3 |
| InChIKey | CQXKOBSAILGVFL-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |