C21H27NO4 — CID 92985064
(2S)-1-[(2R)-2-[(4-methylphenoxy)methyl]morpholin-4-yl]-3-phenoxypropan-2-ol (PubChem CID 92985064) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-[(4-methylphenoxy)methyl]morpholin-4-yl]-3-phenoxypropan-2-ol.
| Compound Name | (2S)-1-[(2R)-2-[(4-methylphenoxy)methyl]morpholin-4-yl]-3-phenoxypropan-2-ol |
|---|---|
| PubChem CID | 92985064 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | (2S)-1-[(2R)-2-[(4-methylphenoxy)methyl]morpholin-4-yl]-3-phenoxypropan-2-ol |
| SMILES | Cc1ccc(OC[C@H]2CN(C[C@H](O)COc3ccccc3)CCO2)cc1 |
| InChI | InChI=1S/C21H27NO4/c1-17-7-9-20(10-8-17)26-16-21-14-22(11-12-24-21)13-18(23)15-25-19-5-3-2-4-6-19/h2-10,18,21,23H,11-16H2,1H3/t18-,21+/m0/s1 |
| InChIKey | CYHKHAFNZLUNJO-GHTZIAJQSA-N |
| XLogP | 2.51 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |