C18H29NO4 — CID 42849347
1-[2-[(3-methylphenoxy)methyl]morpholin-4-yl]-3-propan-2-yloxypropan-2-ol (PubChem CID 42849347) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is 1-[2-[(3-methylphenoxy)methyl]morpholin-4-yl]-3-propan-2-yloxypropan-2-ol.
| Compound Name | 1-[2-[(3-methylphenoxy)methyl]morpholin-4-yl]-3-propan-2-yloxypropan-2-ol |
|---|---|
| PubChem CID | 42849347 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | 1-[2-[(3-methylphenoxy)methyl]morpholin-4-yl]-3-propan-2-yloxypropan-2-ol |
| SMILES | Cc1cccc(OCC2CN(CC(O)COC(C)C)CCO2)c1 |
| InChI | InChI=1S/C18H29NO4/c1-14(2)22-12-16(20)10-19-7-8-21-18(11-19)13-23-17-6-4-5-15(3)9-17/h4-6,9,14,16,18,20H,7-8,10-13H2,1-3H3 |
| InChIKey | YSRMUGZPMNBGMW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |