C20H22N2O3 — CID 110885577
4-[2-hydroxy-3-(2-phenylmorpholin-4-yl)propoxy]benzonitrile (PubChem CID 110885577) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is 4-[2-hydroxy-3-(2-phenylmorpholin-4-yl)propoxy]benzonitrile.
| Compound Name | 4-[2-hydroxy-3-(2-phenylmorpholin-4-yl)propoxy]benzonitrile |
|---|---|
| PubChem CID | 110885577 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 4-[2-hydroxy-3-(2-phenylmorpholin-4-yl)propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCC(O)CN2CCOC(c3ccccc3)C2)cc1 |
| InChI | InChI=1S/C20H22N2O3/c21-12-16-6-8-19(9-7-16)25-15-18(23)13-22-10-11-24-20(14-22)17-4-2-1-3-5-17/h1-9,18,20,23H,10-11,13-15H2 |
| InChIKey | QQDOWAWIODQFJM-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 65.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |