C15H20FNO3 — CID 86795528
4-[2-(1,3-dioxolan-2-yl)ethyl]-2-(3-fluorophenyl)morpholine (PubChem CID 86795528) has the molecular formula C15H20FNO3 and a molecular weight of 281.33 g/mol. Its IUPAC name is 4-[2-(1,3-dioxolan-2-yl)ethyl]-2-(3-fluorophenyl)morpholine.
| Compound Name | 4-[2-(1,3-dioxolan-2-yl)ethyl]-2-(3-fluorophenyl)morpholine |
|---|---|
| PubChem CID | 86795528 |
| Molecular Formula | C15H20FNO3 |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 4-[2-(1,3-dioxolan-2-yl)ethyl]-2-(3-fluorophenyl)morpholine |
| SMILES | Fc1cccc(C2CN(CCC3OCCO3)CCO2)c1 |
| InChI | InChI=1S/C15H20FNO3/c16-13-3-1-2-12(10-13)14-11-17(6-7-18-14)5-4-15-19-8-9-20-15/h1-3,10,14-15H,4-9,11H2 |
| InChIKey | MYODOEWXZJDBMS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |