C11H14FNO — CID 77271439
2-(3-fluorophenyl)-4-methylmorpholine (PubChem CID 77271439) has the molecular formula C11H14FNO and a molecular weight of 195.24 g/mol. Its IUPAC name is 2-(3-fluorophenyl)-4-methylmorpholine.
| Compound Name | 2-(3-fluorophenyl)-4-methylmorpholine |
|---|---|
| PubChem CID | 77271439 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 2-(3-fluorophenyl)-4-methylmorpholine |
| SMILES | CN1CCOC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C11H14FNO/c1-13-5-6-14-11(8-13)9-3-2-4-10(12)7-9/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | FMPASAAJMPOASQ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |