C16H16FNO3S — CID 138003841
5-[[2-(3-fluorophenyl)morpholin-4-yl]methyl]thiophene-2-carboxylic acid (PubChem CID 138003841) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is 5-[[2-(3-fluorophenyl)morpholin-4-yl]methyl]thiophene-2-carboxylic acid.
| Compound Name | 5-[[2-(3-fluorophenyl)morpholin-4-yl]methyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 138003841 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 5-[[2-(3-fluorophenyl)morpholin-4-yl]methyl]thiophene-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CN2CCOC(c3cccc(F)c3)C2)s1 |
| InChI | InChI=1S/C16H16FNO3S/c17-12-3-1-2-11(8-12)14-10-18(6-7-21-14)9-13-4-5-15(22-13)16(19)20/h1-5,8,14H,6-7,9-10H2,(H,19,20) |
| InChIKey | XZVZMLQPSDEQIB-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |