C22H26Cl2FNO3 — CID 138959811
1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-propylphenoxy)propan-2-ol (PubChem CID 138959811) has the molecular formula C22H26Cl2FNO3 and a molecular weight of 442.36 g/mol. Its IUPAC name is 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-propylphenoxy)propan-2-ol.
| Compound Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-propylphenoxy)propan-2-ol |
|---|---|
| PubChem CID | 138959811 |
| Molecular Formula | C22H26Cl2FNO3 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.13 |
| IUPAC Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-propylphenoxy)propan-2-ol |
| SMILES | CCCc1ccc(OCC(O)CN2CCOC(c3cc(F)c(Cl)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C22H26Cl2FNO3/c1-2-3-15-4-6-17(7-5-15)29-14-16(27)12-26-8-9-28-22(13-26)18-10-21(25)20(24)11-19(18)23/h4-7,10-11,16,22,27H,2-3,8-9,12-14H2,1H3 |
| InChIKey | UIRMGAYQSIPTCI-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|