C21H24BrCl3FNO4 — CID 138959824
1-[2-(4-bromophenoxy)ethoxy]-3-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propan-2-ol;hydrochloride (PubChem CID 138959824) has the molecular formula C21H24BrCl3FNO4 and a molecular weight of 559.69 g/mol. Its IUPAC name is 1-[2-(4-bromophenoxy)ethoxy]-3-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(4-bromophenoxy)ethoxy]-3-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959824 |
| Molecular Formula | C21H24BrCl3FNO4 |
| Molecular Weight | 559.69 g/mol |
| Exact Mass | 556.99 |
| IUPAC Name | 1-[2-(4-bromophenoxy)ethoxy]-3-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propan-2-ol;hydrochloride |
| SMILES | Cl.OC(COCCOc1ccc(Br)cc1)CN1CCOC(c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C21H23BrCl2FNO4.ClH/c22-14-1-3-16(4-2-14)29-8-7-28-13-15(27)11-26-5-6-30-21(12-26)17-9-20(25)19(24)10-18(17)23;/h1-4,9-10,15,21,27H,5-8,11-13H2;1H |
| InChIKey | YAHKBQJWOVGLKU-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.69 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|