C15H16Cl2FN3O — CID 95303821
(2R)-2-(2,4-dichloro-5-fluorophenyl)-4-[(1-methylimidazol-2-yl)methyl]morpholine (PubChem CID 95303821) has the molecular formula C15H16Cl2FN3O and a molecular weight of 344.22 g/mol. Its IUPAC name is (2R)-2-(2,4-dichloro-5-fluorophenyl)-4-[(1-methylimidazol-2-yl)methyl]morpholine.
| Compound Name | (2R)-2-(2,4-dichloro-5-fluorophenyl)-4-[(1-methylimidazol-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 95303821 |
| Molecular Formula | C15H16Cl2FN3O |
| Molecular Weight | 344.22 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (2R)-2-(2,4-dichloro-5-fluorophenyl)-4-[(1-methylimidazol-2-yl)methyl]morpholine |
| SMILES | Cn1ccnc1CN1CCO[C@H](c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H16Cl2FN3O/c1-20-3-2-19-15(20)9-21-4-5-22-14(8-21)10-6-13(18)12(17)7-11(10)16/h2-3,6-7,14H,4-5,8-9H2,1H3/t14-/m0/s1 |
| InChIKey | HFTOHQKJJRJNFN-AWEZNQCLSA-N |
| XLogP | 3.44 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.22 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|