C14H14Cl2FN3O2 — CID 95303237
(2S)-2-(2,4-dichloro-5-fluorophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]morpholine (PubChem CID 95303237) has the molecular formula C14H14Cl2FN3O2 and a molecular weight of 346.19 g/mol. Its IUPAC name is (2S)-2-(2,4-dichloro-5-fluorophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]morpholine.
| Compound Name | (2S)-2-(2,4-dichloro-5-fluorophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]morpholine |
|---|---|
| PubChem CID | 95303237 |
| Molecular Formula | C14H14Cl2FN3O2 |
| Molecular Weight | 346.19 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | (2S)-2-(2,4-dichloro-5-fluorophenyl)-4-[(5-methyl-1,3,4-oxadiazol-2-yl)methyl]morpholine |
| SMILES | Cc1nnc(CN2CCO[C@@H](c3cc(F)c(Cl)cc3Cl)C2)o1 |
| InChI | InChI=1S/C14H14Cl2FN3O2/c1-8-18-19-14(22-8)7-20-2-3-21-13(6-20)9-4-12(17)11(16)5-10(9)15/h4-5,13H,2-3,6-7H2,1H3/t13-/m1/s1 |
| InChIKey | XXHPSXOLHCGWBK-CYBMUJFWSA-N |
| XLogP | 3.40 |
| TPSA | 51.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.19 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|