C13H15Cl2FN2O2 — CID 99103788
(2R)-2-[(2S)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propanamide (PubChem CID 99103788) has the molecular formula C13H15Cl2FN2O2 and a molecular weight of 321.18 g/mol. Its IUPAC name is (2R)-2-[(2S)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propanamide.
| Compound Name | (2R)-2-[(2S)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propanamide |
|---|---|
| PubChem CID | 99103788 |
| Molecular Formula | C13H15Cl2FN2O2 |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | (2R)-2-[(2S)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]propanamide |
| SMILES | C[C@H](C(N)=O)N1CCO[C@@H](c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H15Cl2FN2O2/c1-7(13(17)19)18-2-3-20-12(6-18)8-4-11(16)10(15)5-9(8)14/h4-5,7,12H,2-3,6H2,1H3,(H2,17,19)/t7-,12-/m1/s1 |
| InChIKey | ADHJGXZTYGYBBY-JMCQJSRRSA-N |
| XLogP | 2.38 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|