C17H13Cl3FNO2 — CID 155946524
(4-chlorophenyl)-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]methanone (PubChem CID 155946524) has the molecular formula C17H13Cl3FNO2 and a molecular weight of 388.65 g/mol. Its IUPAC name is (4-chlorophenyl)-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]methanone.
| Compound Name | (4-chlorophenyl)-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]methanone |
|---|---|
| PubChem CID | 155946524 |
| Molecular Formula | C17H13Cl3FNO2 |
| Molecular Weight | 388.65 g/mol |
| Exact Mass | 387.00 |
| IUPAC Name | (4-chlorophenyl)-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]methanone |
| SMILES | O=C(c1ccc(Cl)cc1)N1CCOC(c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C17H13Cl3FNO2/c18-11-3-1-10(2-4-11)17(23)22-5-6-24-16(9-22)12-7-15(21)14(20)8-13(12)19/h1-4,7-8,16H,5-6,9H2 |
| InChIKey | SDTCVUWYPRKJRZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.65 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|