C16H19Cl2FN2O3 — CID 120931507
[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone (PubChem CID 120931507) has the molecular formula C16H19Cl2FN2O3 and a molecular weight of 377.24 g/mol. Its IUPAC name is [2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone.
| Compound Name | [2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone |
|---|---|
| PubChem CID | 120931507 |
| Molecular Formula | C16H19Cl2FN2O3 |
| Molecular Weight | 377.24 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | [2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-[(2R,3S)-2-methylmorpholin-3-yl]methanone |
| SMILES | C[C@H]1OCCN[C@@H]1C(=O)N1CCOC(c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C16H19Cl2FN2O3/c1-9-15(20-2-4-23-9)16(22)21-3-5-24-14(8-21)10-6-13(19)12(18)7-11(10)17/h6-7,9,14-15,20H,2-5,8H2,1H3/t9-,14?,15+/m1/s1 |
| InChIKey | MKRLJSIOBQCPIG-OHRKYMRTSA-N |
| XLogP | 2.41 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.24 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|