C18H17Cl2FN2O2 — CID 119777400
2-(4-aminophenyl)-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanone (PubChem CID 119777400) has the molecular formula C18H17Cl2FN2O2 and a molecular weight of 383.25 g/mol. Its IUPAC name is 2-(4-aminophenyl)-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanone.
| Compound Name | 2-(4-aminophenyl)-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 119777400 |
| Molecular Formula | C18H17Cl2FN2O2 |
| Molecular Weight | 383.25 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 2-(4-aminophenyl)-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanone |
| SMILES | Nc1ccc(CC(=O)N2CCOC(c3cc(F)c(Cl)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C18H17Cl2FN2O2/c19-14-9-15(20)16(21)8-13(14)17-10-23(5-6-25-17)18(24)7-11-1-3-12(22)4-2-11/h1-4,8-9,17H,5-7,10,22H2 |
| InChIKey | KXGZINSMFHSUES-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|