C15H19Cl2FN2O3 — CID 119777428
1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone (PubChem CID 119777428) has the molecular formula C15H19Cl2FN2O3 and a molecular weight of 365.23 g/mol. Its IUPAC name is 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 119777428 |
| Molecular Formula | C15H19Cl2FN2O3 |
| Molecular Weight | 365.23 g/mol |
| Exact Mass | 364.08 |
| IUPAC Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)N1CCOC(c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C15H19Cl2FN2O3/c1-22-4-2-19-8-15(21)20-3-5-23-14(9-20)10-6-13(18)12(17)7-11(10)16/h6-7,14,19H,2-5,8-9H2,1H3 |
| InChIKey | YUEGCDHJBZHTDW-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.23 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|