C15H20Cl2N2O3 — CID 119769922
1-[2-(3,4-dichlorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone (PubChem CID 119769922) has the molecular formula C15H20Cl2N2O3 and a molecular weight of 347.24 g/mol. Its IUPAC name is 1-[2-(3,4-dichlorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone.
| Compound Name | 1-[2-(3,4-dichlorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone |
|---|---|
| PubChem CID | 119769922 |
| Molecular Formula | C15H20Cl2N2O3 |
| Molecular Weight | 347.24 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 1-[2-(3,4-dichlorophenyl)morpholin-4-yl]-2-(2-methoxyethylamino)ethanone |
| SMILES | COCCNCC(=O)N1CCOC(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C15H20Cl2N2O3/c1-21-6-4-18-9-15(20)19-5-7-22-14(10-19)11-2-3-12(16)13(17)8-11/h2-3,8,14,18H,4-7,9-10H2,1H3 |
| InChIKey | QDBLOEZOUNTKHM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.24 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|