C17H22Cl3FN2O3 — CID 119777417
[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone;hydrochloride (PubChem CID 119777417) has the molecular formula C17H22Cl3FN2O3 and a molecular weight of 427.73 g/mol. Its IUPAC name is [2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone;hydrochloride.
| Compound Name | [2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119777417 |
| Molecular Formula | C17H22Cl3FN2O3 |
| Molecular Weight | 427.73 g/mol |
| Exact Mass | 426.07 |
| IUPAC Name | [2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone;hydrochloride |
| SMILES | COC1(C(=O)N2CCOC(c3cc(F)c(Cl)cc3Cl)C2)CCNCC1.Cl |
| InChI | InChI=1S/C17H21Cl2FN2O3.ClH/c1-24-17(2-4-21-5-3-17)16(23)22-6-7-25-15(10-22)11-8-14(20)13(19)9-12(11)18;/h8-9,15,21H,2-7,10H2,1H3;1H |
| InChIKey | MRJWBUUAHYGIIS-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.73 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|