C17H23BrN2O3 — CID 119757095
[2-(3-bromophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone (PubChem CID 119757095) has the molecular formula C17H23BrN2O3 and a molecular weight of 383.29 g/mol. Its IUPAC name is [2-(3-bromophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone.
| Compound Name | [2-(3-bromophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone |
|---|---|
| PubChem CID | 119757095 |
| Molecular Formula | C17H23BrN2O3 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [2-(3-bromophenyl)morpholin-4-yl]-(4-methoxypiperidin-4-yl)methanone |
| SMILES | COC1(C(=O)N2CCOC(c3cccc(Br)c3)C2)CCNCC1 |
| InChI | InChI=1S/C17H23BrN2O3/c1-22-17(5-7-19-8-6-17)16(21)20-9-10-23-15(12-20)13-3-2-4-14(18)11-13/h2-4,11,15,19H,5-10,12H2,1H3 |
| InChIKey | WEYFEKNATDUCRN-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |