C14H18Cl3FN2O2 — CID 119777421
3-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-one;hydrochloride (PubChem CID 119777421) has the molecular formula C14H18Cl3FN2O2 and a molecular weight of 371.67 g/mol. Its IUPAC name is 3-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-one;hydrochloride.
| Compound Name | 3-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-one;hydrochloride |
|---|---|
| PubChem CID | 119777421 |
| Molecular Formula | C14H18Cl3FN2O2 |
| Molecular Weight | 371.67 g/mol |
| Exact Mass | 370.04 |
| IUPAC Name | 3-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-one;hydrochloride |
| SMILES | CC(N)CC(=O)N1CCOC(c2cc(F)c(Cl)cc2Cl)C1.Cl |
| InChI | InChI=1S/C14H17Cl2FN2O2.ClH/c1-8(18)4-14(20)19-2-3-21-13(7-19)9-5-12(17)11(16)6-10(9)15;/h5-6,8,13H,2-4,7,18H2,1H3;1H |
| InChIKey | AJPLJTRUDSUGSE-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.67 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|