C14H18Cl3FN2O3 — CID 120989276
2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-methoxypropan-1-one;hydrochloride (PubChem CID 120989276) has the molecular formula C14H18Cl3FN2O3 and a molecular weight of 387.67 g/mol. Its IUPAC name is 2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-methoxypropan-1-one;hydrochloride.
| Compound Name | 2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-methoxypropan-1-one;hydrochloride |
|---|---|
| PubChem CID | 120989276 |
| Molecular Formula | C14H18Cl3FN2O3 |
| Molecular Weight | 387.67 g/mol |
| Exact Mass | 386.04 |
| IUPAC Name | 2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-methoxypropan-1-one;hydrochloride |
| SMILES | COCC(N)C(=O)N1CCOC(c2cc(F)c(Cl)cc2Cl)C1.Cl |
| InChI | InChI=1S/C14H17Cl2FN2O3.ClH/c1-21-7-12(18)14(20)19-2-3-22-13(6-19)8-4-11(17)10(16)5-9(8)15;/h4-5,12-13H,2-3,6-7,18H2,1H3;1H |
| InChIKey | ZHEUHYMIZRRMKA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.67 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|