C17H21Cl2FN2O3 — CID 120792454
2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(oxan-4-yl)ethanone (PubChem CID 120792454) has the molecular formula C17H21Cl2FN2O3 and a molecular weight of 391.27 g/mol. Its IUPAC name is 2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(oxan-4-yl)ethanone.
| Compound Name | 2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(oxan-4-yl)ethanone |
|---|---|
| PubChem CID | 120792454 |
| Molecular Formula | C17H21Cl2FN2O3 |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 390.09 |
| IUPAC Name | 2-amino-1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(oxan-4-yl)ethanone |
| SMILES | NC(C(=O)N1CCOC(c2cc(F)c(Cl)cc2Cl)C1)C1CCOCC1 |
| InChI | InChI=1S/C17H21Cl2FN2O3/c18-12-8-13(19)14(20)7-11(12)15-9-22(3-6-25-15)17(23)16(21)10-1-4-24-5-2-10/h7-8,10,15-16H,1-6,9,21H2 |
| InChIKey | YZWRQJSQDDKOKF-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|