C14H18Cl2FNO2 — CID 95339618
4-[(2R)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-ol (PubChem CID 95339618) has the molecular formula C14H18Cl2FNO2 and a molecular weight of 322.21 g/mol. Its IUPAC name is 4-[(2R)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-ol.
| Compound Name | 4-[(2R)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-ol |
|---|---|
| PubChem CID | 95339618 |
| Molecular Formula | C14H18Cl2FNO2 |
| Molecular Weight | 322.21 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 4-[(2R)-2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]butan-1-ol |
| SMILES | OCCCCN1CCO[C@H](c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C14H18Cl2FNO2/c15-11-8-12(16)13(17)7-10(11)14-9-18(4-6-20-14)3-1-2-5-19/h7-8,14,19H,1-6,9H2/t14-/m0/s1 |
| InChIKey | HHYWVUOJZNOFMP-AWEZNQCLSA-N |
| XLogP | 3.28 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.21 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|