C14H13N3OS2 — CID 133363726
4-thieno[2,3-d]pyrimidin-4-yl-2-thiophen-2-ylmorpholine (PubChem CID 133363726) has the molecular formula C14H13N3OS2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 4-thieno[2,3-d]pyrimidin-4-yl-2-thiophen-2-ylmorpholine.
| Compound Name | 4-thieno[2,3-d]pyrimidin-4-yl-2-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 133363726 |
| Molecular Formula | C14H13N3OS2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | 4-thieno[2,3-d]pyrimidin-4-yl-2-thiophen-2-ylmorpholine |
| SMILES | c1csc(C2CN(c3ncnc4sccc34)CCO2)c1 |
| InChI | InChI=1S/C14H13N3OS2/c1-2-12(19-6-1)11-8-17(4-5-18-11)13-10-3-7-20-14(10)16-9-15-13/h1-3,6-7,9,11H,4-5,8H2 |
| InChIKey | IYFUWFGQNBSTHB-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |