About 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine
4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine (PubChem CID 133363467) has the molecular formula C19H17N5OS
and a molecular weight of 363.45 g/mol. Its IUPAC name is 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine.
Molecular Properties
| Compound Name | 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine |
| PubChem CID | 133363467 |
| Molecular Formula | C19H17N5OS |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine |
| SMILES | c1ccc(-n2ncc3c(N4CCOC(c5cccs5)C4)ncnc32)cc1 |
| InChI | InChI=1S/C19H17N5OS/c1-2-5-14(6-3-1)24-19-15(11-22-24)18(20-13-21-19)23-8-9-25-16(12-23)17-7-4-10-26-17/h1-7,10-11,13,16H,8-9,12H2 |
| InChIKey | NSRVCBBQGCEYJT-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 56.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine?
The IUPAC name of 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine (CID 133363467) is 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine.
What is the SMILES notation for 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine?
The canonical SMILES for 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine is c1ccc(-n2ncc3c(N4CCOC(c5cccs5)C4)ncnc32)cc1.
What is the InChIKey of 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine?
The InChIKey is NSRVCBBQGCEYJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17N5OS/c1-2-5-14(6-3-1)24-19-15(11-22-24)18(20-13-21-19)23-8-9-25-16(12-23)17-7-4-10-26-17/h1-7,10-11,13,16H,8-9,12H2.
What are the key properties of 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine?
4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine has a molecular weight of 363.45 g/mol, XLogP of 3.45, 3 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-phenylpyrazolo[5,4-d]pyrimidin-4-yl)-2-thiophen-2-ylmorpholine is sourced from PubChem (CID 133363467), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).