C16H18N2O4S — CID 133363702
4-[2-(methoxymethyl)-4-nitrophenyl]-2-thiophen-2-ylmorpholine (PubChem CID 133363702) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 4-[2-(methoxymethyl)-4-nitrophenyl]-2-thiophen-2-ylmorpholine.
| Compound Name | 4-[2-(methoxymethyl)-4-nitrophenyl]-2-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 133363702 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 4-[2-(methoxymethyl)-4-nitrophenyl]-2-thiophen-2-ylmorpholine |
| SMILES | COCc1cc([N+](=O)[O-])ccc1N1CCOC(c2cccs2)C1 |
| InChI | InChI=1S/C16H18N2O4S/c1-21-11-12-9-13(18(19)20)4-5-14(12)17-6-7-22-15(10-17)16-3-2-8-23-16/h2-5,8-9,15H,6-7,10-11H2,1H3 |
| InChIKey | YIOKWNBARSEQGS-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|