C20H24N2O4 — CID 133341079
2-(2,4-dimethylphenyl)-4-[2-(methoxymethyl)-4-nitrophenyl]morpholine (PubChem CID 133341079) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 2-(2,4-dimethylphenyl)-4-[2-(methoxymethyl)-4-nitrophenyl]morpholine.
| Compound Name | 2-(2,4-dimethylphenyl)-4-[2-(methoxymethyl)-4-nitrophenyl]morpholine |
|---|---|
| PubChem CID | 133341079 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 2-(2,4-dimethylphenyl)-4-[2-(methoxymethyl)-4-nitrophenyl]morpholine |
| SMILES | COCc1cc([N+](=O)[O-])ccc1N1CCOC(c2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C20H24N2O4/c1-14-4-6-18(15(2)10-14)20-12-21(8-9-26-20)19-7-5-17(22(23)24)11-16(19)13-25-3/h4-7,10-11,20H,8-9,12-13H2,1-3H3 |
| InChIKey | AKFFLUURVUXJBX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 64.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|