C15H14F3N3O4 — CID 133323042
2-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole (PubChem CID 133323042) has the molecular formula C15H14F3N3O4 and a molecular weight of 357.29 g/mol. Its IUPAC name is 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole.
| Compound Name | 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole |
|---|---|
| PubChem CID | 133323042 |
| Molecular Formula | C15H14F3N3O4 |
| Molecular Weight | 357.29 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | 2-[2,6-dinitro-4-(trifluoromethyl)phenyl]-1,3,3a,4,7,7a-hexahydroisoindole |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CC2CC=CCC2C1 |
| InChI | InChI=1S/C15H14F3N3O4/c16-15(17,18)11-5-12(20(22)23)14(13(6-11)21(24)25)19-7-9-3-1-2-4-10(9)8-19/h1-2,5-6,9-10H,3-4,7-8H2 |
| InChIKey | HRUBWNLMVNXJFJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|