About (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine
(2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine (PubChem CID 94819276) has the molecular formula C15H18N4O3
and a molecular weight of 302.33 g/mol. Its IUPAC name is (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine.
Molecular Properties
| Compound Name | (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine |
| PubChem CID | 94819276 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine |
| SMILES | Cc1nn(C)c(N2CCO[C@H](c3ccccc3)C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H18N4O3/c1-11-14(19(20)21)15(17(2)16-11)18-8-9-22-13(10-18)12-6-4-3-5-7-12/h3-7,13H,8-10H2,1-2H3/t13-/m0/s1 |
| InChIKey | CXYGESQSYUJDET-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 73.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine?
The IUPAC name of (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine (CID 94819276) is (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine.
What is the SMILES notation for (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine?
The canonical SMILES for (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine is Cc1nn(C)c(N2CCO[C@H](c3ccccc3)C2)c1[N+](=O)[O-].
What is the InChIKey of (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine?
The InChIKey is CXYGESQSYUJDET-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H18N4O3/c1-11-14(19(20)21)15(17(2)16-11)18-8-9-22-13(10-18)12-6-4-3-5-7-12/h3-7,13H,8-10H2,1-2H3/t13-/m0/s1.
What are the key properties of (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine?
(2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine has a molecular weight of 302.33 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-4-(1,3-dimethyl-4-nitropyrazol-5-yl)-2-phenylmorpholine is sourced from PubChem (CID 94819276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).