C12H14N4O2S — CID 47213598
5-(1,3-dimethyl-4-nitropyrazol-5-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine (PubChem CID 47213598) has the molecular formula C12H14N4O2S and a molecular weight of 278.34 g/mol. Its IUPAC name is 5-(1,3-dimethyl-4-nitropyrazol-5-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine.
| Compound Name | 5-(1,3-dimethyl-4-nitropyrazol-5-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
|---|---|
| PubChem CID | 47213598 |
| Molecular Formula | C12H14N4O2S |
| Molecular Weight | 278.34 g/mol |
| Exact Mass | 278.08 |
| IUPAC Name | 5-(1,3-dimethyl-4-nitropyrazol-5-yl)-6,7-dihydro-4H-thieno[3,2-c]pyridine |
| SMILES | Cc1nn(C)c(N2CCc3sccc3C2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14N4O2S/c1-8-11(16(17)18)12(14(2)13-8)15-5-3-10-9(7-15)4-6-19-10/h4,6H,3,5,7H2,1-2H3 |
| InChIKey | XDERMWGAPMSIFL-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 64.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.34 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|